cas: 172975-98-3 — see every product listed under this CAS number, including other names
2-Methyl[1,1'-biphenyl]-3-amine, 97%, 97% (CAS 172975-98-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DI10-100mg |
| cas | 172975-98-3 |
| size | 100mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 659.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-methyl-3-phenylaniline (CAS 172975-98-3) is a chemical compound with the molecular formula C13H13N and a molecular weight of 183.25 g/mol. IUPAC name: 2-methyl-3-phenylaniline. InChIKey: WXVGZIZBMFJASZ-UHFFFAOYSA-N.
| Molecular formula | C13H13N |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | 2-methyl-3-phenylaniline |
| InChIKey | WXVGZIZBMFJASZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)