cas: 387350-63-2 — see every product listed under this CAS number, including other names
2-Methyl-1,6-naphthyridine-3-carboxylic acid (CAS 387350-63-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023696-1G |
| cas | 387350-63-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1440.14 Pln |
| delivery time | 2-3 weeks |
|---|
2-methyl-1,6-naphthyridine-3-carboxylic acid (CAS 387350-63-2) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 2-methyl-1,6-naphthyridine-3-carboxylic acid. InChIKey: QPJMZENOEJWDKD-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 2-methyl-1,6-naphthyridine-3-carboxylic acid |
| InChIKey | QPJMZENOEJWDKD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C2C=NC=CC2=N1)C(=O)O |
Computed by PubChem (NCBI)