CAS 387350-63-2 appears in our catalog under these names: 2-Methyl-1,6-naphthyridine-3-carboxylic acid, 98%, 2-Methyl-1,6-naphthyridine-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 25g.
2-methyl-1,6-naphthyridine-3-carboxylic acid (CAS 387350-63-2) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 2-methyl-1,6-naphthyridine-3-carboxylic acid. InChIKey: QPJMZENOEJWDKD-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 2-methyl-1,6-naphthyridine-3-carboxylic acid |
| InChIKey | QPJMZENOEJWDKD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C2C=NC=CC2=N1)C(=O)O |
Computed by PubChem (NCBI)