cas: 50389-29-2 — see every product listed under this CAS number, including other names
2-Methyl-2-phenoxypropanoyl chloride, 95+% (CAS 50389-29-2) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A530944-5g |
| cas | 50389-29-2 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 7178.92 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-methyl-2-phenoxypropanoyl chloride (CAS 50389-29-2) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: 2-methyl-2-phenoxypropanoyl chloride. InChIKey: WWIJGHHDQFJHQW-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | 2-methyl-2-phenoxypropanoyl chloride |
| InChIKey | WWIJGHHDQFJHQW-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)Cl)OC1=CC=CC=C1 |
Computed by PubChem (NCBI)