CAS 50389-29-2 appears in our catalog under these names: 2-Methyl-2-phenoxypropanoyl chloride, 2-Methyl-2-phenoxypropanoyl chloride, 95%, 2-Methyl-2-phenoxypropanoyl chloride, 95+%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1000mg, 1g, 5g.
2-methyl-2-phenoxypropanoyl chloride (CAS 50389-29-2) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: 2-methyl-2-phenoxypropanoyl chloride. InChIKey: WWIJGHHDQFJHQW-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | 2-methyl-2-phenoxypropanoyl chloride |
| InChIKey | WWIJGHHDQFJHQW-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)Cl)OC1=CC=CC=C1 |
Computed by PubChem (NCBI)