cas: 1231892-37-7 — see every product listed under this CAS number, including other names
2-Methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 95%, 95% (CAS 1231892-37-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111K5B-10g |
| cas | 1231892-37-7 |
| size | 10g |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 2075.60 Pln | |
| Chemat | 25g | 4278.80 Pln | |
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 1158.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 1231892-37-7) is a chemical compound with the molecular formula C14H18BNO2 and a molecular weight of 243.11 g/mol. IUPAC name: 2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: IHKQPZXLCHYHGK-UHFFFAOYSA-N.
| Molecular formula | C14H18BNO2 |
|---|---|
| Molecular weight | 243.11 g/mol |
| IUPAC name | 2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | IHKQPZXLCHYHGK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)C#N)C |
Computed by PubChem (NCBI)