CAS 396131-82-1 appears in our catalog under these names: 3-Cyanomethylphenylboronic acid, pinacol ester, 96%, 2-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetonitrile 98%, 3-Cyanomethylphenylboronic acid, pinacol ester, 98%, 98%, 2-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetonitrile, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 5g, 1g, 10g.
2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetonitrile (CAS 396131-82-1) is a chemical compound with the molecular formula C14H18BNO2 and a molecular weight of 243.11 g/mol. IUPAC name: 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetonitrile. InChIKey: LIWPKYSGWSFPEE-UHFFFAOYSA-N.
| Molecular formula | C14H18BNO2 |
|---|---|
| Molecular weight | 243.11 g/mol |
| IUPAC name | 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetonitrile |
| InChIKey | LIWPKYSGWSFPEE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)CC#N |
Computed by PubChem (NCBI)