CAS 937366-54-6 appears in our catalog under these names: Indole-3-boronic acid pinacol ester, 96%, 3–(4,4,5,5–Tetramethyl–1,3,2–dioxaborolan–2–yl)–1H–indole, 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole 98%, 3-Indoleboronic Acid Pinacol Ester, 98%, 98%, 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 500mg.
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (CAS 937366-54-6) is a chemical compound with the molecular formula C14H18BNO2 and a molecular weight of 243.11 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole. InChIKey: WQPRSRMWYVTUTE-UHFFFAOYSA-N.
| Molecular formula | C14H18BNO2 |
|---|---|
| Molecular weight | 243.11 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
| InChIKey | WQPRSRMWYVTUTE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CNC3=CC=CC=C23 |
Computed by PubChem (NCBI)