cas: 154365-40-9 — see every product listed under this CAS number, including other names
2-Methyl-3-oxo-3,4-dihydro-2H-benzo[b][1,4]oxazine-2-carboxylic acid, 95% (CAS 154365-40-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F448878-5G |
| cas | 154365-40-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 4059.01 Pln | |
| Fluorochem | 10g | 6438.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-methyl-3-oxo-4H-1,4-benzoxazine-2-carboxylic acid (CAS 154365-40-9) is a chemical compound with the molecular formula C10H9NO4 and a molecular weight of 207.18 g/mol. IUPAC name: 2-methyl-3-oxo-4H-1,4-benzoxazine-2-carboxylic acid. InChIKey: HNDTULADLKGMDH-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4 |
|---|---|
| Molecular weight | 207.18 g/mol |
| IUPAC name | 2-methyl-3-oxo-4H-1,4-benzoxazine-2-carboxylic acid |
| InChIKey | HNDTULADLKGMDH-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC2=CC=CC=C2O1)C(=O)O |
Computed by PubChem (NCBI)