cas: 1092352-65-2 — see every product listed under this CAS number, including other names
2-Methyl-3-oxo-3,4-dihydro-2H-benzo[b][1,4]oxazine-6-carboxylic acid 95% (CAS 1092352-65-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A153460-100mg |
| cas | 1092352-65-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 259.12 Pln | |
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 720.81 Pln | |
| Ambeed | 5g | 2133.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A153460 |
2-methyl-3-oxo-4H-1,4-benzoxazine-6-carboxylic acid (CAS 1092352-65-2) is a chemical compound with the molecular formula C10H9NO4 and a molecular weight of 207.18 g/mol. IUPAC name: 2-methyl-3-oxo-4H-1,4-benzoxazine-6-carboxylic acid. InChIKey: JDFHPMWWJCAFQJ-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4 |
|---|---|
| Molecular weight | 207.18 g/mol |
| IUPAC name | 2-methyl-3-oxo-4H-1,4-benzoxazine-6-carboxylic acid |
| InChIKey | JDFHPMWWJCAFQJ-UHFFFAOYSA-N |
| SMILES | CC1C(=O)NC2=C(O1)C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)