cas: 252562-00-8 — see every product listed under this CAS number, including other names
2-Methyl-4-(methylsulfonyl)aniline, >95%, >95% (CAS 252562-00-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114HMX-100mg |
| cas | 252562-00-8 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 414.80 Pln | |
| Chemat | 250mg | 539.60 Pln | |
| Chemat | 1g | 1029.20 Pln | |
| Chemat | 5g | 2867.60 Pln | |
| Chemat | 10g | 5229.20 Pln | |
| Chemat | 25g | 11781.20 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
2-methyl-4-methylsulfonylaniline (CAS 252562-00-8) is a chemical compound with the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. IUPAC name: 2-methyl-4-methylsulfonylaniline. InChIKey: DWQJEYKNLZWXLJ-UHFFFAOYSA-N.
| Molecular formula | C8H11NO2S |
|---|---|
| Molecular weight | 185.25 g/mol |
| IUPAC name | 2-methyl-4-methylsulfonylaniline |
| InChIKey | DWQJEYKNLZWXLJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)S(=O)(=O)C)N |
Computed by PubChem (NCBI)