CAS 172843-96-8 is the registry number for Methyl (2s)-2-amino-3-(thiophen-3-yl)propanoate, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
Methyl (2S)-2-amino-3-thiophen-3-ylpropanoate (CAS 172843-96-8) is a chemical compound with the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. IUPAC name: methyl (2S)-2-amino-3-thiophen-3-ylpropanoate. InChIKey: LOQJOEVPJCMGKJ-ZETCQYMHSA-N.
| Molecular formula | C8H11NO2S |
|---|---|
| Molecular weight | 185.25 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-thiophen-3-ylpropanoate |
| InChIKey | LOQJOEVPJCMGKJ-ZETCQYMHSA-N |
| SMILES | COC(=O)[C@H](CC1=CSC=C1)N |
Computed by PubChem (NCBI)