CAS 173020-15-0 appears in our catalog under these names: N,3-Dimethylbenzenesulfonamide, 95%, N,3-Dimethylbenzenesulfonamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 25g, 50mg, 0,5g.
N,3-dimethylbenzenesulfonamide (CAS 173020-15-0) is a chemical compound with the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. IUPAC name: N,3-dimethylbenzenesulfonamide. InChIKey: IGJVRTGOWHNMOJ-UHFFFAOYSA-N.
| Molecular formula | C8H11NO2S |
|---|---|
| Molecular weight | 185.25 g/mol |
| IUPAC name | N,3-dimethylbenzenesulfonamide |
| InChIKey | IGJVRTGOWHNMOJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)S(=O)(=O)NC |
Computed by PubChem (NCBI)