2-Methyl-5,6,7,8,9,10-hexahydro-6,9-epiminocycloocta[d]pyrimidin-4(3H)-one hydrochloride, 95%
cas: 2702343-19-7 — see every product listed under this CAS number, including other names
2-Methyl-5,6,7,8,9,10-hexahydro-6,9-epiminocycloocta[d]pyrimidin-4(3H)-one hydrochloride, 95% (CAS 2702343-19-7) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2976896-10mg |
| cas | 2702343-19-7 |
| size | 10mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10mg | 587.31 Pln | |
| Ambeed | 25mg | 1049.00 Pln | |
| Ambeed | 50mg | 1733.19 Pln | |
| Ambeed | 100mg | 2890.19 Pln | |
| Ambeed | 250mg | 5137.44 Pln | |
| Ambeed | 1g | 16284.69 Pln | |
| BLDpharm | 10mg | 630.91 Pln | |
| BLDpharm | 25mg | 1125.18 Pln | |
| BLDpharm | 50mg | 1863.81 Pln | |
| BLDpharm | 100mg | 3113.37 Pln | |
| BLDpharm | 250mg | 5534.74 Pln | |
| BLDpharm | 1g | 17552.73 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one;hydrochloride (CAS 2702343-19-7) is a chemical compound with the molecular formula C11H16ClN3O and a molecular weight of 241.72 g/mol. IUPAC name: 5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one;hydrochloride. InChIKey: VLOWGHVKZOXUAI-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN3O |
|---|---|
| Molecular weight | 241.72 g/mol |
| IUPAC name | 5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one;hydrochloride |
| InChIKey | VLOWGHVKZOXUAI-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(CC3CCC(C2)N3)C(=O)N1.Cl |
Computed by PubChem (NCBI)