Products 2702343-19-7
CAS 2702343-19-7 is the registry number for 2-Methyl-5,6,7,8,9,10-hexahydro-6,9-epiminocycloocta[d]pyrimidin-4(3H)-one hydrochloride, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one;hydrochloride (CAS 2702343-19-7) is a chemical compound with the molecular formula C11H16ClN3O and a molecular weight of 241.72 g/mol. IUPAC name: 5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one;hydrochloride. InChIKey: VLOWGHVKZOXUAI-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN3O |
|---|---|
| Molecular weight | 241.72 g/mol |
| IUPAC name | 5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one;hydrochloride |
| InChIKey | VLOWGHVKZOXUAI-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(CC3CCC(C2)N3)C(=O)N1.Cl |
Computed by PubChem (NCBI)