cas: 1192056-62-4 — see every product listed under this CAS number, including other names
2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxazole, 98% (CAS 1192056-62-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 50mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A236387-1g |
| cas | 1192056-62-4 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 8493.94 Pln | |
| AmBeed | 5g | 41115.55 Pln | |
| AmBeed | 50mg | 1189.72 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazole (CAS 1192056-62-4) is a chemical compound with the molecular formula C10H16BNO3 and a molecular weight of 209.05 g/mol. IUPAC name: 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazole. InChIKey: KKXBGDVHCQOKBO-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO3 |
|---|---|
| Molecular weight | 209.05 g/mol |
| IUPAC name | 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazole |
| InChIKey | KKXBGDVHCQOKBO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(O2)C |
Computed by PubChem (NCBI)