Products 1451390-91-2

CAS 1451390-91-2 appears in our catalog under these names: 2-Methyl-6-isobutoxypyridine-3-boronic acid, 98%, (6-Isobutoxy-2-methylpyridin-3-yl)boronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

[2-methyl-6-(2-methylpropoxy)-3-pyridinyl]boronic acid (CAS 1451390-91-2) is a chemical compound with the molecular formula C10H16BNO3 and a molecular weight of 209.05 g/mol. IUPAC name: [2-methyl-6-(2-methylpropoxy)-3-pyridinyl]boronic acid. InChIKey: UXVYTZHMEMUJIW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16BNO3
Molecular weight209.05 g/mol
IUPAC name[2-methyl-6-(2-methylpropoxy)-3-pyridinyl]boronic acid
InChIKeyUXVYTZHMEMUJIW-UHFFFAOYSA-N
SMILESB(C1=C(N=C(C=C1)OCC(C)C)C)(O)O

Computed by PubChem (NCBI)