CAS 1451390-91-2 appears in our catalog under these names: 2-Methyl-6-isobutoxypyridine-3-boronic acid, 98%, (6-Isobutoxy-2-methylpyridin-3-yl)boronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g.
[2-methyl-6-(2-methylpropoxy)-3-pyridinyl]boronic acid (CAS 1451390-91-2) is a chemical compound with the molecular formula C10H16BNO3 and a molecular weight of 209.05 g/mol. IUPAC name: [2-methyl-6-(2-methylpropoxy)-3-pyridinyl]boronic acid. InChIKey: UXVYTZHMEMUJIW-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO3 |
|---|---|
| Molecular weight | 209.05 g/mol |
| IUPAC name | [2-methyl-6-(2-methylpropoxy)-3-pyridinyl]boronic acid |
| InChIKey | UXVYTZHMEMUJIW-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)OCC(C)C)C)(O)O |
Computed by PubChem (NCBI)