Products 2096330-20-8

CAS 2096330-20-8 is the registry number for 2-Butoxy-5-methylpyridine-3-boronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

(2-butoxy-5-methyl-3-pyridinyl)boronic acid (CAS 2096330-20-8) is a chemical compound with the molecular formula C10H16BNO3 and a molecular weight of 209.05 g/mol. IUPAC name: (2-butoxy-5-methyl-3-pyridinyl)boronic acid. InChIKey: CZLJBFIYFSIFEU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16BNO3
Molecular weight209.05 g/mol
IUPAC name(2-butoxy-5-methyl-3-pyridinyl)boronic acid
InChIKeyCZLJBFIYFSIFEU-UHFFFAOYSA-N
SMILESB(C1=CC(=CN=C1OCCCC)C)(O)O

Computed by PubChem (NCBI)