cas: 1257554-08-7 — see every product listed under this CAS number, including other names
2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine 95+% (CAS 1257554-08-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A276545-100mg |
| cas | 1257554-08-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 731.94 Pln | |
| Ambeed | 250mg | 1210.31 Pln | |
| Ambeed | 1g | 3084.88 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A276545 |
2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine (CAS 1257554-08-7) is a chemical compound with the molecular formula C12H19BN2O2 and a molecular weight of 234.10 g/mol. IUPAC name: 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine. InChIKey: NSWWPEOEZRGFNZ-UHFFFAOYSA-N.
| Molecular formula | C12H19BN2O2 |
|---|---|
| Molecular weight | 234.10 g/mol |
| IUPAC name | 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine |
| InChIKey | NSWWPEOEZRGFNZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)C)N |
Computed by PubChem (NCBI)