cas: 610768-32-6 — see every product listed under this CAS number, including other names
2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 97%, 97% (CAS 610768-32-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EBEV-250mg |
| cas | 610768-32-6 |
| size | 250mg |
| availability | 900g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 25g | 386.00 Pln | |
| Chemat | 100g | 1355.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 610768-32-6) is a chemical compound with the molecular formula C12H18BNO2 and a molecular weight of 219.09 g/mol. IUPAC name: 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: JEECGGXGHJUYMN-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO2 |
|---|---|
| Molecular weight | 219.09 g/mol |
| IUPAC name | 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | JEECGGXGHJUYMN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)C |
Computed by PubChem (NCBI)