Products 1256355-44-8

CAS 1256355-44-8 is the registry number for 3-(1-Pyrrolidinoethyl)phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 10g, 5g.

Structural formula: {0} (CAS {1})

[3-(1-pyrrolidin-1-ylethyl)phenyl]boronic acid (CAS 1256355-44-8) is a chemical compound with the molecular formula C12H18BNO2 and a molecular weight of 219.09 g/mol. IUPAC name: [3-(1-pyrrolidin-1-ylethyl)phenyl]boronic acid. InChIKey: OSQBDXBDCHOEAV-UHFFFAOYSA-N.

Identity
Molecular formulaC12H18BNO2
Molecular weight219.09 g/mol
IUPAC name[3-(1-pyrrolidin-1-ylethyl)phenyl]boronic acid
InChIKeyOSQBDXBDCHOEAV-UHFFFAOYSA-N
SMILESB(C1=CC(=CC=C1)C(C)N2CCCC2)(O)O

Computed by PubChem (NCBI)