Products 2411875-80-2
CAS 2411875-80-2 appears in our catalog under these names: [4-(1-Methylpiperidin-4-yl)phenyl]boronic acid, 97%, (4-(1-Methylpiperidin-4-yl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
[4-(1-methylpiperidin-4-yl)phenyl]boronic acid (CAS 2411875-80-2) is a chemical compound with the molecular formula C12H18BNO2 and a molecular weight of 219.09 g/mol. IUPAC name: [4-(1-methylpiperidin-4-yl)phenyl]boronic acid. InChIKey: PERYWXNUEBFAAQ-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO2 |
|---|---|
| Molecular weight | 219.09 g/mol |
| IUPAC name | [4-(1-methylpiperidin-4-yl)phenyl]boronic acid |
| InChIKey | PERYWXNUEBFAAQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2CCN(CC2)C)(O)O |
Computed by PubChem (NCBI)