CAS 170275-10-2 appears in our catalog under these names: 2-Methyl-6-nitrobenzenesulfonamide, 95%, 2-Methyl-6-nitrobenzene-1-sulfonamide, 95%, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg.
2-methyl-6-nitrobenzenesulfonamide (CAS 170275-10-2) is a chemical compound with the molecular formula C7H8N2O4S and a molecular weight of 216.22 g/mol. IUPAC name: 2-methyl-6-nitrobenzenesulfonamide. InChIKey: RBJVDTBCPCLEJF-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4S |
|---|---|
| Molecular weight | 216.22 g/mol |
| IUPAC name | 2-methyl-6-nitrobenzenesulfonamide |
| InChIKey | RBJVDTBCPCLEJF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)[N+](=O)[O-])S(=O)(=O)N |
Computed by PubChem (NCBI)