CAS 5825-62-7 appears in our catalog under these names: 4-Nitro methanesulfonanilide, 97%, N-(4-Nitrophenyl)methanesulfonamide 95%, 4-Nitro methanesulfonanilide, 95%, 95%, N-(4-Nitrophenyl)methanesulfonamide, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 100g, 5g.
N-(4-nitrophenyl)methanesulfonamide (CAS 5825-62-7) is a chemical compound with the molecular formula C7H8N2O4S and a molecular weight of 216.22 g/mol. IUPAC name: N-(4-nitrophenyl)methanesulfonamide. InChIKey: AXEHDVUAWILBRN-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4S |
|---|---|
| Molecular weight | 216.22 g/mol |
| IUPAC name | N-(4-nitrophenyl)methanesulfonamide |
| InChIKey | AXEHDVUAWILBRN-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)