CAS 56825-33-3 is the registry number for 2-(Ethanesulfonyl)-3-nitropyridine, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-ethylsulfonyl-3-nitropyridine (CAS 56825-33-3) is a chemical compound with the molecular formula C7H8N2O4S and a molecular weight of 216.22 g/mol. IUPAC name: 2-ethylsulfonyl-3-nitropyridine. InChIKey: NXNGEWXMQZQJHX-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4S |
|---|---|
| Molecular weight | 216.22 g/mol |
| IUPAC name | 2-ethylsulfonyl-3-nitropyridine |
| InChIKey | NXNGEWXMQZQJHX-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=C(C=CC=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)