2-Methyl-6-nitropyridine, 95%
cas: 18368-61-1 — see every product listed under this CAS number, including other names
2-Methyl-6-nitropyridine, 95% (CAS 18368-61-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100g. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | QH-9140-1g |
| cas | 18368-61-1 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Fluorochem | 1g | 112.48 Pln | |
| Fluorochem | 5g | 237.43 Pln | |
| Fluorochem | 10g | 404.04 Pln | |
| Fluorochem | 25g | 492.55 Pln | |
| Fluorochem | 100g | 1757.73 Pln | |
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 225.75 Pln | |
| Ambeed | 25g | 442.69 Pln | |
| Ambeed | 100g | 1544.06 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 174.80 Pln | |
| Chemat | 10g | 285.20 Pln | |
| Chemat | 25g | 371.60 Pln | |
| Chemat | 100g | 1019.60 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2-methyl-6-nitropyridine (CAS 18368-61-1) is a chemical compound with the molecular formula C6H6N2O2 and a molecular weight of 138.12 g/mol. IUPAC name: 2-methyl-6-nitropyridine. InChIKey: DEEYZLKYZZUQPC-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O2 |
|---|---|
| Molecular weight | 138.12 g/mol |
| IUPAC name | 2-methyl-6-nitropyridine |
| InChIKey | DEEYZLKYZZUQPC-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)