CAS 18368-61-1 appears in our catalog under these names: 2-Methyl-6-nitropyridine, 95%, 2–Methyl–6–nitropyridine, 2-Methyl-6-nitropyridine 95%, 2-Methyl-6-nitropyridine, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100g.
2-methyl-6-nitropyridine (CAS 18368-61-1) is a chemical compound with the molecular formula C6H6N2O2 and a molecular weight of 138.12 g/mol. IUPAC name: 2-methyl-6-nitropyridine. InChIKey: DEEYZLKYZZUQPC-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O2 |
|---|---|
| Molecular weight | 138.12 g/mol |
| IUPAC name | 2-methyl-6-nitropyridine |
| InChIKey | DEEYZLKYZZUQPC-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)