Products 1076-28-4
CAS 1076-28-4 appears in our catalog under these names: 2-Methylquinoline n-oxide, 95%, 2-Methylquinoline N-Oxide, 98% GC, 2–Methylquinoline N–Oxide, 2-Methylquinoline N-Oxide, >98.0%(GC), 2-Methylquinoline N-Oxide, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g, 250mg, 25g, 200mg.
2-methyl-1-oxidoquinolin-1-ium (CAS 1076-28-4) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 2-methyl-1-oxidoquinolin-1-ium. InChIKey: FZJUONUBFWNHNU-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 2-methyl-1-oxidoquinolin-1-ium |
| InChIKey | FZJUONUBFWNHNU-UHFFFAOYSA-N |
| SMILES | CC1=[N+](C2=CC=CC=C2C=C1)[O-] |
Computed by PubChem (NCBI)