cas: 63735-42-2 — see every product listed under this CAS number, including other names
2-Naphthalenesulfinic acid sodium salt 95% (CAS 63735-42-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1125765-250mg |
| cas | 63735-42-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 392.62 Pln | |
| Ambeed | 1g | 464.94 Pln | |
| Ambeed | 5g | 1249.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1125765 |
Sodium naphthalene-2-sulfinate (CAS 63735-42-2) is a chemical compound with the molecular formula C10H7NaO2S and a molecular weight of 214.22 g/mol. IUPAC name: sodium naphthalene-2-sulfinate. InChIKey: JGGFVSGYTHUAOQ-UHFFFAOYSA-M.
| Molecular formula | C10H7NaO2S |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | sodium naphthalene-2-sulfinate |
| InChIKey | JGGFVSGYTHUAOQ-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C=C(C=CC2=C1)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)