2-Naphthoyl fluoride, 97%
cas: 37827-83-1 — see every product listed under this CAS number, including other names
2-Naphthoyl fluoride, 97% (CAS 37827-83-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1443048-250mg |
| cas | 37827-83-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 737.50 Pln | |
| Ambeed | 5g | 2328.38 Pln | |
| Ambeed | 10g | 3691.19 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 400.40 Pln | |
| Chemat | 5g | 1235.60 Pln | |
| BLDpharm | 250mg | 314.36 Pln | |
| BLDpharm | 1g | 719.77 Pln | |
| BLDpharm | 5g | 2291.44 Pln | |
| BLDpharm | 10g | 3624.30 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Naphthalene-2-carbonyl fluoride (CAS 37827-83-1) is a chemical compound with the molecular formula C11H7FO and a molecular weight of 174.17 g/mol. IUPAC name: naphthalene-2-carbonyl fluoride. InChIKey: YDNZYORUANJTLF-UHFFFAOYSA-N.
| Molecular formula | C11H7FO |
|---|---|
| Molecular weight | 174.17 g/mol |
| IUPAC name | naphthalene-2-carbonyl fluoride |
| InChIKey | YDNZYORUANJTLF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)F |
Computed by PubChem (NCBI)