CAS 1261808-12-1 appears in our catalog under these names: 3-fluoronaphthalene-1-carbaldehyde 97%, 3-fluoronaphthalene-1-carbaldehyde, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
3-fluoronaphthalene-1-carbaldehyde (CAS 1261808-12-1) is a chemical compound with the molecular formula C11H7FO and a molecular weight of 174.17 g/mol. IUPAC name: 3-fluoronaphthalene-1-carbaldehyde. InChIKey: SQNYSXIZCRUTLT-UHFFFAOYSA-N.
| Molecular formula | C11H7FO |
|---|---|
| Molecular weight | 174.17 g/mol |
| IUPAC name | 3-fluoronaphthalene-1-carbaldehyde |
| InChIKey | SQNYSXIZCRUTLT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=C2C=O)F |
Computed by PubChem (NCBI)