Products 37827-83-1
CAS 37827-83-1 appears in our catalog under these names: 2-Naphthoyl fluoride, 95-<97%, 2-Naphthoyl fluoride, ≥97-<99%, 2-Naphthoyl fluoride 97%, 2-Naphthoyl fluoride, 97%, 97%. Offered by: Hoffman Fine Chemicals, Ambeed, Chemat. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g, 250mg, 1g.
Naphthalene-2-carbonyl fluoride (CAS 37827-83-1) is a chemical compound with the molecular formula C11H7FO and a molecular weight of 174.17 g/mol. IUPAC name: naphthalene-2-carbonyl fluoride. InChIKey: YDNZYORUANJTLF-UHFFFAOYSA-N.
| Molecular formula | C11H7FO |
|---|---|
| Molecular weight | 174.17 g/mol |
| IUPAC name | naphthalene-2-carbonyl fluoride |
| InChIKey | YDNZYORUANJTLF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)F |
Computed by PubChem (NCBI)