2-Naphthyl phenyl ketone, 98%
cas: 644-13-3 — see every product listed under this CAS number, including other names
2-Naphthyl phenyl ketone, 98% (CAS 644-13-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A682951-250mg |
| cas | 644-13-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 676.31 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 328.40 Pln | |
| Chemat | 25g | 1355.60 Pln | |
| BLDpharm | 250mg | 131.09 Pln | |
| BLDpharm | 1g | 225.50 Pln | |
| BLDpharm | 5g | 725.32 Pln | |
| BLDpharm | 25g | 2691.30 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Naphthalen-2-yl(phenyl)methanone (CAS 644-13-3) is a chemical compound with the molecular formula C17H12O and a molecular weight of 232.28 g/mol. IUPAC name: naphthalen-2-yl(phenyl)methanone. InChIKey: SJNXJRVDSTZUFB-UHFFFAOYSA-N.
| Molecular formula | C17H12O |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | naphthalen-2-yl(phenyl)methanone |
| InChIKey | SJNXJRVDSTZUFB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC3=CC=CC=C3C=C2 |
Computed by PubChem (NCBI)
