CAS 728919-26-4 appears in our catalog under these names: 3–(Naphthalen–2–yl)benzaldehyde, 3-(Naphthalen-2-yl)benzaldehyde 97%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-naphthalen-2-ylbenzaldehyde (CAS 728919-26-4) is a chemical compound with the molecular formula C17H12O and a molecular weight of 232.28 g/mol. IUPAC name: 3-naphthalen-2-ylbenzaldehyde. InChIKey: BRFKOOFPFQKSIG-UHFFFAOYSA-N.
| Molecular formula | C17H12O |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | 3-naphthalen-2-ylbenzaldehyde |
| InChIKey | BRFKOOFPFQKSIG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=CC=CC(=C3)C=O |
Computed by PubChem (NCBI)