CAS 133550-74-0 is the registry number for 4-Phenyl-1-naphthaldehyde, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
4-phenylnaphthalene-1-carbaldehyde (CAS 133550-74-0) is a chemical compound with the molecular formula C17H12O and a molecular weight of 232.28 g/mol. IUPAC name: 4-phenylnaphthalene-1-carbaldehyde. InChIKey: YNRYYBCXDSMIRQ-UHFFFAOYSA-N.
| Molecular formula | C17H12O |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | 4-phenylnaphthalene-1-carbaldehyde |
| InChIKey | YNRYYBCXDSMIRQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C3=CC=CC=C32)C=O |
Computed by PubChem (NCBI)