cas: 13551-90-1 — see every product listed under this CAS number, including other names
2-Nitro-1-(oxiran-2-ylmethyl)-1H-imidazole, ≥97%, ≥97% (CAS 13551-90-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HU7T-100mg |
| cas | 13551-90-1 |
| size | 100mg |
| availability | 1.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 496.40 Pln | |
| Chemat | 250mg | 832.40 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
2-nitro-1-(oxiran-2-ylmethyl)imidazole (CAS 13551-90-1) is a chemical compound with the molecular formula C6H7N3O3 and a molecular weight of 169.14 g/mol. IUPAC name: 2-nitro-1-(oxiran-2-ylmethyl)imidazole. InChIKey: SYFMSLVOHQZYEB-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O3 |
|---|---|
| Molecular weight | 169.14 g/mol |
| IUPAC name | 2-nitro-1-(oxiran-2-ylmethyl)imidazole |
| InChIKey | SYFMSLVOHQZYEB-UHFFFAOYSA-N |
| SMILES | C1C(O1)CN2C=CN=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)