cas: 833486-94-5 — see every product listed under this CAS number, including other names
2-Nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 95% (CAS 833486-94-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F235228-1G |
| cas | 833486-94-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 388.42 Pln | |
| Fluorochem | 10g | 726.85 Pln | |
| Fluorochem | 25g | 1403.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 833486-94-5) is a chemical compound with the molecular formula C12H17BN2O4 and a molecular weight of 264.09 g/mol. IUPAC name: 2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: QOYJKGGBFKVKDP-UHFFFAOYSA-N.
| Molecular formula | C12H17BN2O4 |
|---|---|
| Molecular weight | 264.09 g/mol |
| IUPAC name | 2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | QOYJKGGBFKVKDP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)