CAS 1008138-66-6 appears in our catalog under these names: 2-Methyl-5-nitro-pyridine-boronic acid pinacol ester, 95%, 2-Methyl-5-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 98+%, 98+%, 2-METHYL-5-NITROPYRIDINE-3-BORONIC ACID PINACOL ESTER, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
2-methyl-5-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1008138-66-6) is a chemical compound with the molecular formula C12H17BN2O4 and a molecular weight of 264.09 g/mol. IUPAC name: 2-methyl-5-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: IYYWRANRHLVQPQ-UHFFFAOYSA-N.
| Molecular formula | C12H17BN2O4 |
|---|---|
| Molecular weight | 264.09 g/mol |
| IUPAC name | 2-methyl-5-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | IYYWRANRHLVQPQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2C)[N+](=O)[O-] |
Computed by PubChem (NCBI)