CAS 871329-51-0 appears in our catalog under these names: 3-Amino-5-nitrophenylboronic acid, pinacol ester, 96%, 3-Amino-5-nitrophenylboronic acid pinacol ester, 3-Amino-5-nitrophenylboronic acid, pinacol ester, 97%, 97%, 3-Amino-5-nitrobenzeneboronic acid pinacol ester, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 50mg, 500mg, 1000mg.
3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 871329-51-0) is a chemical compound with the molecular formula C12H17BN2O4 and a molecular weight of 264.09 g/mol. IUPAC name: 3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: KLYYWEHPIHBBHC-UHFFFAOYSA-N.
| Molecular formula | C12H17BN2O4 |
|---|---|
| Molecular weight | 264.09 g/mol |
| IUPAC name | 3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | KLYYWEHPIHBBHC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)[N+](=O)[O-])N |
Computed by PubChem (NCBI)