cas: 1072945-08-4 — see every product listed under this CAS number, including other names
2-Nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol, 98% (CAS 1072945-08-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F604690-1G |
| cas | 1072945-08-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 476.93 Pln | |
| Fluorochem | 5g | 1320.39 Pln | |
| Fluorochem | 10g | 2278.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 1072945-08-4) is a chemical compound with the molecular formula C12H16BNO5 and a molecular weight of 265.07 g/mol. IUPAC name: 2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: YCZPFDHFMRUGAF-UHFFFAOYSA-N.
| Molecular formula | C12H16BNO5 |
|---|---|
| Molecular weight | 265.07 g/mol |
| IUPAC name | 2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | YCZPFDHFMRUGAF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)