Products 850568-19-3

CAS 850568-19-3 is the registry number for Ethyl 3-(4-boronobenzamido)propionate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

[4-[(3-ethoxy-3-oxopropyl)carbamoyl]phenyl]boronic acid (CAS 850568-19-3) is a chemical compound with the molecular formula C12H16BNO5 and a molecular weight of 265.07 g/mol. IUPAC name: [4-[(3-ethoxy-3-oxopropyl)carbamoyl]phenyl]boronic acid. InChIKey: KXZXCGXIKIEDCR-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16BNO5
Molecular weight265.07 g/mol
IUPAC name[4-[(3-ethoxy-3-oxopropyl)carbamoyl]phenyl]boronic acid
InChIKeyKXZXCGXIKIEDCR-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)C(=O)NCCC(=O)OCC)(O)O

Computed by PubChem (NCBI)