Products 1339927-68-2

CAS 1339927-68-2 is the registry number for 3-Hydroxy-4-nitrophenylboronic acid, pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 1339927-68-2) is a chemical compound with the molecular formula C12H16BNO5 and a molecular weight of 265.07 g/mol. IUPAC name: 2-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: LCTYSKLEXBBODM-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16BNO5
Molecular weight265.07 g/mol
IUPAC name2-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol
InChIKeyLCTYSKLEXBBODM-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)[N+](=O)[O-])O

Computed by PubChem (NCBI)