CAS 1339927-68-2 is the registry number for 3-Hydroxy-4-nitrophenylboronic acid, pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 1339927-68-2) is a chemical compound with the molecular formula C12H16BNO5 and a molecular weight of 265.07 g/mol. IUPAC name: 2-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: LCTYSKLEXBBODM-UHFFFAOYSA-N.
| Molecular formula | C12H16BNO5 |
|---|---|
| Molecular weight | 265.07 g/mol |
| IUPAC name | 2-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | LCTYSKLEXBBODM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)[N+](=O)[O-])O |
Computed by PubChem (NCBI)