cas: 54029-45-7 — see every product listed under this CAS number, including other names
2-Nitro-4-thiocyanatoaniline 97% (CAS 54029-45-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A185683-250mg |
| cas | 54029-45-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 281.38 Pln | |
| Ambeed | 100g | 748.62 Pln | |
| Ambeed | 500g | 2111.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A185683 |
(4-amino-3-nitrophenyl) thiocyanate (CAS 54029-45-7) is a chemical compound with the molecular formula C7H5N3O2S and a molecular weight of 195.20 g/mol. IUPAC name: (4-amino-3-nitrophenyl) thiocyanate. InChIKey: QUWHIBBGKKRYFW-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | (4-amino-3-nitrophenyl) thiocyanate |
| InChIKey | QUWHIBBGKKRYFW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1SC#N)[N+](=O)[O-])N |
Computed by PubChem (NCBI)