CAS 1020253-47-7 appears in our catalog under these names: 3-(1H-1,2,3-triazol-1-yl)thiophene-2-carboxylic acid, 95%, 3-(1, 2, 3)Triazol-1-yl-thiophene-2-carboxylic acid, 97%, 3-(1H-1,2,3-Triazol-1-yl)thiophene-2-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
3-(triazol-1-yl)thiophene-2-carboxylic acid (CAS 1020253-47-7) is a chemical compound with the molecular formula C7H5N3O2S and a molecular weight of 195.20 g/mol. IUPAC name: 3-(triazol-1-yl)thiophene-2-carboxylic acid. InChIKey: BOZOINXKHGGUHQ-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 3-(triazol-1-yl)thiophene-2-carboxylic acid |
| InChIKey | BOZOINXKHGGUHQ-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1N2C=CN=N2)C(=O)O |
Computed by PubChem (NCBI)