CAS 797807-53-5 is the registry number for 5-(4H-1,2,4-Triazol-3-ylthio)-2-furaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
5-(1H-1,2,4-triazol-5-ylsulfanyl)furan-2-carbaldehyde (CAS 797807-53-5) is a chemical compound with the molecular formula C7H5N3O2S and a molecular weight of 195.20 g/mol. IUPAC name: 5-(1H-1,2,4-triazol-5-ylsulfanyl)furan-2-carbaldehyde. InChIKey: MJDCESOFVFBUOJ-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 5-(1H-1,2,4-triazol-5-ylsulfanyl)furan-2-carbaldehyde |
| InChIKey | MJDCESOFVFBUOJ-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)SC2=NC=NN2)C=O |
Computed by PubChem (NCBI)