cas: 16090-33-8 — see every product listed under this CAS number, including other names
2-Nitrobenzene-1,4-diol, 98%, 98% (CAS 16090-33-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112VGZ-100mg |
| cas | 16090-33-8 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 510.80 Pln | |
| Chemat | 10g | 818.00 Pln | |
| Chemat | 25g | 1576.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-nitrobenzene-1,4-diol (CAS 16090-33-8) is a chemical compound with the molecular formula C6H5NO4 and a molecular weight of 155.11 g/mol. IUPAC name: 2-nitrobenzene-1,4-diol. InChIKey: VIIYYMZOGKODQG-UHFFFAOYSA-N.
| Molecular formula | C6H5NO4 |
|---|---|
| Molecular weight | 155.11 g/mol |
| IUPAC name | 2-nitrobenzene-1,4-diol |
| InChIKey | VIIYYMZOGKODQG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)[N+](=O)[O-])O |
Computed by PubChem (NCBI)