Products 6665-98-1
CAS 6665-98-1 appears in our catalog under these names: 3-nitrobenzene-1,2-diol, 95%, 3-Nitrobenzene-1,2-diol, >95% (HPLC), 3-Nitro-benzene-1,2-diol, 3-Nitrobenzene-1,2-diol 95%, 3-Nitrobenzene-1,2-diol, 95%, 95%. Offered by: Combi-blocks, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 2000mg, 100mg, 50mg.
3-nitrobenzene-1,2-diol (CAS 6665-98-1) is a chemical compound with the molecular formula C6H5NO4 and a molecular weight of 155.11 g/mol. IUPAC name: 3-nitrobenzene-1,2-diol. InChIKey: YHKWFDPEASWKFQ-UHFFFAOYSA-N.
| Molecular formula | C6H5NO4 |
|---|---|
| Molecular weight | 155.11 g/mol |
| IUPAC name | 3-nitrobenzene-1,2-diol |
| InChIKey | YHKWFDPEASWKFQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)