CAS 16090-33-8 appears in our catalog under these names: 2-Nitrobenzene-1,4-diol, 95%, 2-Nitrobenzene-1,4-diol, >95% (HPLC), 2–Nitrobenzene–1,4–diol, 2-Nitrobenzene-1,4-diol 95%, 2-Nitrobenzene-1,4-diol, 98%, 98%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg, 500mg, 50mg, 25g, 10g.
2-nitrobenzene-1,4-diol (CAS 16090-33-8) is a chemical compound with the molecular formula C6H5NO4 and a molecular weight of 155.11 g/mol. IUPAC name: 2-nitrobenzene-1,4-diol. InChIKey: VIIYYMZOGKODQG-UHFFFAOYSA-N.
| Molecular formula | C6H5NO4 |
|---|---|
| Molecular weight | 155.11 g/mol |
| IUPAC name | 2-nitrobenzene-1,4-diol |
| InChIKey | VIIYYMZOGKODQG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)[N+](=O)[O-])O |
Computed by PubChem (NCBI)