cas: 433-98-7 — see every product listed under this CAS number, including other names
2-Nitrobenzene-1-sulfonyl fluoride 98% (CAS 433-98-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A585309-5g |
| cas | 433-98-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 225.75 Pln | |
| Ambeed | 25g | 498.31 Pln | |
| Ambeed | 100g | 1783.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A585309 |
2-nitrobenzenesulfonyl fluoride (CAS 433-98-7) is a chemical compound with the molecular formula C6H4FNO4S and a molecular weight of 205.17 g/mol. IUPAC name: 2-nitrobenzenesulfonyl fluoride. InChIKey: HSQIQAVSSNKMBM-UHFFFAOYSA-N.
| Molecular formula | C6H4FNO4S |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 2-nitrobenzenesulfonyl fluoride |
| InChIKey | HSQIQAVSSNKMBM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])S(=O)(=O)F |
Computed by PubChem (NCBI)