cas: 5906-99-0 — see every product listed under this CAS number, including other names
2-Nitrobenzenesulfonohydrazide, 95% (CAS 5906-99-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F634334-100MG |
| cas | 5906-99-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 325.94 Pln | |
| Fluorochem | 250mg | 450.90 Pln | |
| Fluorochem | 1g | 846.59 Pln | |
| Fluorochem | 5g | 2424.16 Pln | |
| Fluorochem | 10g | 4267.27 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-nitrobenzenesulfonohydrazide (CAS 5906-99-0) is a chemical compound with the molecular formula C6H7N3O4S and a molecular weight of 217.21 g/mol. IUPAC name: 2-nitrobenzenesulfonohydrazide. InChIKey: QENBJCMCPIVGMF-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O4S |
|---|---|
| Molecular weight | 217.21 g/mol |
| IUPAC name | 2-nitrobenzenesulfonohydrazide |
| InChIKey | QENBJCMCPIVGMF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])S(=O)(=O)NN |
Computed by PubChem (NCBI)